C16H21NO5P2 — CID 58071540
[2-[3-[2-[hydroxy(methyl)phosphoryl]phenyl]propylamino]phenyl]phosphonic acid (PubChem CID 58071540) has the molecular formula C16H21NO5P2 and a molecular weight of 369.29 g/mol. Its IUPAC name is [2-[3-[2-[hydroxy(methyl)phosphoryl]phenyl]propylamino]phenyl]phosphonic acid.
| Compound Name | [2-[3-[2-[hydroxy(methyl)phosphoryl]phenyl]propylamino]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 58071540 |
| Molecular Formula | C16H21NO5P2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | [2-[3-[2-[hydroxy(methyl)phosphoryl]phenyl]propylamino]phenyl]phosphonic acid |
| SMILES | CP(=O)(O)c1ccccc1CCCNc1ccccc1P(=O)(O)O |
| InChI | InChI=1S/C16H21NO5P2/c1-23(18,19)15-10-4-2-7-13(15)8-6-12-17-14-9-3-5-11-16(14)24(20,21)22/h2-5,7,9-11,17H,6,8,12H2,1H3,(H,18,19)(H2,20,21,22) |
| InChIKey | JQVVCWYRGAREMD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|