C23H19F2N3O2 — CID 58072634
methyl 4-[6-ethyl-5-[2-(6-ethyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2,6-difluorobenzoate (PubChem CID 58072634) has the molecular formula C23H19F2N3O2 and a molecular weight of 407.42 g/mol. Its IUPAC name is methyl 4-[6-ethyl-5-[2-(6-ethyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2,6-difluorobenzoate.
| Compound Name | methyl 4-[6-ethyl-5-[2-(6-ethyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 58072634 |
| Molecular Formula | C23H19F2N3O2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl 4-[6-ethyl-5-[2-(6-ethyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]-2,6-difluorobenzoate |
| SMILES | CCc1ccc(C#Cc2c(CC)ncnc2-c2cc(F)c(C(=O)OC)c(F)c2)cn1 |
| InChI | InChI=1S/C23H19F2N3O2/c1-4-16-8-6-14(12-26-16)7-9-17-20(5-2)27-13-28-22(17)15-10-18(24)21(19(25)11-15)23(29)30-3/h6,8,10-13H,4-5H2,1-3H3 |
| InChIKey | HJGLZGWJAQHZIZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|