C37H44N4O3 — CID 58073194
1-[6-[4-(4-methylbenzoyl)piperidine-1-carbonyl]-3-pyridinyl]-2-[1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]ethanone (PubChem CID 58073194) has the molecular formula C37H44N4O3 and a molecular weight of 592.78 g/mol. Its IUPAC name is 1-[6-[4-(4-methylbenzoyl)piperidine-1-carbonyl]-3-pyridinyl]-2-[1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]ethanone.
| Compound Name | 1-[6-[4-(4-methylbenzoyl)piperidine-1-carbonyl]-3-pyridinyl]-2-[1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 58073194 |
| Molecular Formula | C37H44N4O3 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | 1-[6-[4-(4-methylbenzoyl)piperidine-1-carbonyl]-3-pyridinyl]-2-[1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]ethanone |
| SMILES | Cc1ccc(C(=O)C2CCN(C(=O)c3ccc(C(=O)CC4CCN(Cc5ccc(N6CCCC6)cc5)CC4)cn3)CC2)cc1 |
| InChI | InChI=1S/C37H44N4O3/c1-27-4-8-30(9-5-27)36(43)31-16-22-41(23-17-31)37(44)34-13-10-32(25-38-34)35(42)24-28-14-20-39(21-15-28)26-29-6-11-33(12-7-29)40-18-2-3-19-40/h4-13,25,28,31H,2-3,14-24,26H2,1H3 |
| InChIKey | UTCPCEGCEPZIBA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|