C32H31N5O3 — CID 58073339
4-[4-[2-[6-[4-(4-isocyanophenoxy)piperidine-1-carbonyl]-3-pyridinyl]-2-oxoethyl]piperidin-1-yl]benzonitrile (PubChem CID 58073339) has the molecular formula C32H31N5O3 and a molecular weight of 533.63 g/mol. Its IUPAC name is 4-[4-[2-[6-[4-(4-isocyanophenoxy)piperidine-1-carbonyl]-3-pyridinyl]-2-oxoethyl]piperidin-1-yl]benzonitrile.
| Compound Name | 4-[4-[2-[6-[4-(4-isocyanophenoxy)piperidine-1-carbonyl]-3-pyridinyl]-2-oxoethyl]piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 58073339 |
| Molecular Formula | C32H31N5O3 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 4-[4-[2-[6-[4-(4-isocyanophenoxy)piperidine-1-carbonyl]-3-pyridinyl]-2-oxoethyl]piperidin-1-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(OC2CCN(C(=O)c3ccc(C(=O)CC4CCN(c5ccc(C#N)cc5)CC4)cn3)CC2)cc1 |
| InChI | InChI=1S/C32H31N5O3/c1-34-26-5-9-28(10-6-26)40-29-14-18-37(19-15-29)32(39)30-11-4-25(22-35-30)31(38)20-23-12-16-36(17-13-23)27-7-2-24(21-33)3-8-27/h2-11,22-23,29H,12-20H2 |
| InChIKey | PZZJJIYOMBONFH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|