C32H33N5O2 — CID 58456838
4-[[4-[2-[5-[1-(4-isocyanophenyl)piperidin-4-yl]oxy-2-pyridinyl]-2-oxoethyl]piperidin-1-yl]methyl]benzonitrile (PubChem CID 58456838) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 4-[[4-[2-[5-[1-(4-isocyanophenyl)piperidin-4-yl]oxy-2-pyridinyl]-2-oxoethyl]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[2-[5-[1-(4-isocyanophenyl)piperidin-4-yl]oxy-2-pyridinyl]-2-oxoethyl]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 58456838 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-[[4-[2-[5-[1-(4-isocyanophenyl)piperidin-4-yl]oxy-2-pyridinyl]-2-oxoethyl]piperidin-1-yl]methyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N2CCC(Oc3ccc(C(=O)CC4CCN(Cc5ccc(C#N)cc5)CC4)nc3)CC2)cc1 |
| InChI | InChI=1S/C32H33N5O2/c1-34-27-6-8-28(9-7-27)37-18-14-29(15-19-37)39-30-10-11-31(35-22-30)32(38)20-24-12-16-36(17-13-24)23-26-4-2-25(21-33)3-5-26/h2-11,22,24,29H,12-20,23H2 |
| InChIKey | PAHQBJCYBGYSPJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|