C21H16N2O3 — CID 58073812
2-[4-(3-hydroxyphenyl)phenyl]-6-methyl-1H-benzimidazole-4-carboxylic acid (PubChem CID 58073812) has the molecular formula C21H16N2O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[4-(3-hydroxyphenyl)phenyl]-6-methyl-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-[4-(3-hydroxyphenyl)phenyl]-6-methyl-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 58073812 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[4-(3-hydroxyphenyl)phenyl]-6-methyl-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2nc(-c3ccc(-c4cccc(O)c4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H16N2O3/c1-12-9-17(21(25)26)19-18(10-12)22-20(23-19)14-7-5-13(6-8-14)15-3-2-4-16(24)11-15/h2-11,24H,1H3,(H,22,23)(H,25,26) |
| InChIKey | OLDHBEHXNFYHIQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |