C20H16FNO3 — CID 58075174
2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]methyl]pyridine-3-carboxylic acid (PubChem CID 58075174) has the molecular formula C20H16FNO3 and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]methyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58075174 |
| Molecular Formula | C20H16FNO3 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]methyl]pyridine-3-carboxylic acid |
| SMILES | COc1cccc(-c2ccc(Cc3ncccc3C(=O)O)c(F)c2)c1 |
| InChI | InChI=1S/C20H16FNO3/c1-25-16-5-2-4-13(10-16)14-7-8-15(18(21)11-14)12-19-17(20(23)24)6-3-9-22-19/h2-11H,12H2,1H3,(H,23,24) |
| InChIKey | KLYZSJWPVKVDLL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |