C23H16N2O3 — CID 118078465
2-(3-methoxyphenyl)-3-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethynyl]benzoic acid (PubChem CID 118078465) has the molecular formula C23H16N2O3 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-3-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethynyl]benzoic acid.
| Compound Name | 2-(3-methoxyphenyl)-3-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 118078465 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-(3-methoxyphenyl)-3-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethynyl]benzoic acid |
| SMILES | COc1cccc(-c2c(C#Cc3c[nH]c4ncccc34)cccc2C(=O)O)c1 |
| InChI | InChI=1S/C23H16N2O3/c1-28-18-7-2-6-16(13-18)21-15(5-3-8-20(21)23(26)27)10-11-17-14-25-22-19(17)9-4-12-24-22/h2-9,12-14H,1H3,(H,24,25)(H,26,27) |
| InChIKey | VFDBGMJILXMHJM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|