C24H15N3O2S — CID 118078021
2-(2-methyl-1,3-benzothiazol-5-yl)-3-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethynyl]benzoic acid (PubChem CID 118078021) has the molecular formula C24H15N3O2S and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-(2-methyl-1,3-benzothiazol-5-yl)-3-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethynyl]benzoic acid.
| Compound Name | 2-(2-methyl-1,3-benzothiazol-5-yl)-3-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 118078021 |
| Molecular Formula | C24H15N3O2S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-(2-methyl-1,3-benzothiazol-5-yl)-3-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethynyl]benzoic acid |
| SMILES | Cc1nc2cc(-c3c(C#Cc4c[nH]c5ncccc45)cccc3C(=O)O)ccc2s1 |
| InChI | InChI=1S/C24H15N3O2S/c1-14-27-20-12-16(9-10-21(20)30-14)22-15(4-2-5-19(22)24(28)29)7-8-17-13-26-23-18(17)6-3-11-25-23/h2-6,9-13H,1H3,(H,25,26)(H,28,29) |
| InChIKey | WGYFBEYZZXYVGS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|