C23H19N3O2S — CID 175645929
4-[5-(2-methyl-1,3-benzothiazol-5-yl)naphthalene-1-carbonyl]piperazin-2-one (PubChem CID 175645929) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 4-[5-(2-methyl-1,3-benzothiazol-5-yl)naphthalene-1-carbonyl]piperazin-2-one.
| Compound Name | 4-[5-(2-methyl-1,3-benzothiazol-5-yl)naphthalene-1-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 175645929 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-[5-(2-methyl-1,3-benzothiazol-5-yl)naphthalene-1-carbonyl]piperazin-2-one |
| SMILES | Cc1nc2cc(-c3cccc4c(C(=O)N5CCNC(=O)C5)cccc34)ccc2s1 |
| InChI | InChI=1S/C23H19N3O2S/c1-14-25-20-12-15(8-9-21(20)29-14)16-4-2-6-18-17(16)5-3-7-19(18)23(28)26-11-10-24-22(27)13-26/h2-9,12H,10-11,13H2,1H3,(H,24,27) |
| InChIKey | YFRODRYZTANEGN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |