C20H14Cl3N3O2 — CID 31096259
4-[2-(2,3,4-trichlorophenyl)quinoline-4-carbonyl]piperazin-2-one (PubChem CID 31096259) has the molecular formula C20H14Cl3N3O2 and a molecular weight of 434.71 g/mol. Its IUPAC name is 4-[2-(2,3,4-trichlorophenyl)quinoline-4-carbonyl]piperazin-2-one.
| Compound Name | 4-[2-(2,3,4-trichlorophenyl)quinoline-4-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 31096259 |
| Molecular Formula | C20H14Cl3N3O2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 4-[2-(2,3,4-trichlorophenyl)quinoline-4-carbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2cc(-c3ccc(Cl)c(Cl)c3Cl)nc3ccccc23)CCN1 |
| InChI | InChI=1S/C20H14Cl3N3O2/c21-14-6-5-12(18(22)19(14)23)16-9-13(11-3-1-2-4-15(11)25-16)20(28)26-8-7-24-17(27)10-26/h1-6,9H,7-8,10H2,(H,24,27) |
| InChIKey | WRGPMALUKOYPOP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|