C16H17N3O2 — CID 62045092
1-(2-methylquinoline-4-carbonyl)-1,4-diazepan-5-one (PubChem CID 62045092) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-(2-methylquinoline-4-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-methylquinoline-4-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62045092 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-(2-methylquinoline-4-carbonyl)-1,4-diazepan-5-one |
| SMILES | Cc1cc(C(=O)N2CCNC(=O)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C16H17N3O2/c1-11-10-13(12-4-2-3-5-14(12)18-11)16(21)19-8-6-15(20)17-7-9-19/h2-5,10H,6-9H2,1H3,(H,17,20) |
| InChIKey | DZZYVGINKCEOEO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |