C14H14N2O2S — CID 55153408
1-(1-benzothiophene-3-carbonyl)-1,4-diazepan-5-one (PubChem CID 55153408) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(1-benzothiophene-3-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(1-benzothiophene-3-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 55153408 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-(1-benzothiophene-3-carbonyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2csc3ccccc23)CCN1 |
| InChI | InChI=1S/C14H14N2O2S/c17-13-5-7-16(8-6-15-13)14(18)11-9-19-12-4-2-1-3-10(11)12/h1-4,9H,5-8H2,(H,15,17) |
| InChIKey | SKOUWISVTHYRCO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |