About 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one
4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one (PubChem CID 170715907) has the molecular formula C20H17N3O2S
and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one |
| PubChem CID | 170715907 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2nc(-c3ccccc3)c(-c3ccccc3)s2)CCN1 |
| InChI | InChI=1S/C20H17N3O2S/c24-16-13-23(12-11-21-16)20(25)19-22-17(14-7-3-1-4-8-14)18(26-19)15-9-5-2-6-10-15/h1-10H,11-13H2,(H,21,24) |
| InChIKey | VUKVCIBQKXPECY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one?
The IUPAC name of 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one (CID 170715907) is 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one.
What is the SMILES notation for 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one?
The canonical SMILES for 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one is O=C1CN(C(=O)c2nc(-c3ccccc3)c(-c3ccccc3)s2)CCN1.
What is the InChIKey of 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one?
The InChIKey is VUKVCIBQKXPECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2S/c24-16-13-23(12-11-21-16)20(25)19-22-17(14-7-3-1-4-8-14)18(26-19)15-9-5-2-6-10-15/h1-10H,11-13H2,(H,21,24).
What are the key properties of 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one?
4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one has a molecular weight of 363.44 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-diphenyl-1,3-thiazole-2-carbonyl)piperazin-2-one is sourced from PubChem (CID 170715907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).