C14H13N3O2S — CID 47123816
4-(2-phenyl-1,3-thiazole-4-carbonyl)piperazin-2-one (PubChem CID 47123816) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-(2-phenyl-1,3-thiazole-4-carbonyl)piperazin-2-one.
| Compound Name | 4-(2-phenyl-1,3-thiazole-4-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 47123816 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-(2-phenyl-1,3-thiazole-4-carbonyl)piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2csc(-c3ccccc3)n2)CCN1 |
| InChI | InChI=1S/C14H13N3O2S/c18-12-8-17(7-6-15-12)14(19)11-9-20-13(16-11)10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,15,18) |
| InChIKey | UJCOODUFYMAPAQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |