C13H13N5O2S — CID 90509889
4-[2-(pyridin-2-ylamino)-1,3-thiazole-4-carbonyl]piperazin-2-one (PubChem CID 90509889) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-[2-(pyridin-2-ylamino)-1,3-thiazole-4-carbonyl]piperazin-2-one.
| Compound Name | 4-[2-(pyridin-2-ylamino)-1,3-thiazole-4-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 90509889 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-[2-(pyridin-2-ylamino)-1,3-thiazole-4-carbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2csc(Nc3ccccn3)n2)CCN1 |
| InChI | InChI=1S/C13H13N5O2S/c19-11-7-18(6-5-15-11)12(20)9-8-21-13(16-9)17-10-3-1-2-4-14-10/h1-4,8H,5-7H2,(H,15,19)(H,14,16,17) |
| InChIKey | GNJWINKDBUUIOB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |