C16H20N4OS — CID 90509772
N-cycloheptyl-2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 90509772) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-cycloheptyl-2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-cycloheptyl-2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90509772 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-cycloheptyl-2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1csc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C16H20N4OS/c21-15(18-12-7-3-1-2-4-8-12)13-11-22-16(19-13)20-14-9-5-6-10-17-14/h5-6,9-12H,1-4,7-8H2,(H,18,21)(H,17,19,20) |
| InChIKey | KSWAMVBJHAQBGY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |