C16H13N3O2S2 — CID 31096197
4-[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]piperazin-2-one (PubChem CID 31096197) has the molecular formula C16H13N3O2S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]piperazin-2-one.
| Compound Name | 4-[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 31096197 |
| Molecular Formula | C16H13N3O2S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 4-[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2ccc(-c3nc4ccccc4s3)s2)CCN1 |
| InChI | InChI=1S/C16H13N3O2S2/c20-14-9-19(8-7-17-14)16(21)13-6-5-12(22-13)15-18-10-3-1-2-4-11(10)23-15/h1-6H,7-9H2,(H,17,20) |
| InChIKey | AUYCCLXZCNISGX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |