C18H18N2OS2 — CID 2394761
azepan-1-yl-[5-(1,3-benzothiazol-2-yl)thiophen-2-yl]methanone (PubChem CID 2394761) has the molecular formula C18H18N2OS2 and a molecular weight of 342.49 g/mol. Its IUPAC name is azepan-1-yl-[5-(1,3-benzothiazol-2-yl)thiophen-2-yl]methanone.
| Compound Name | azepan-1-yl-[5-(1,3-benzothiazol-2-yl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 2394761 |
| Molecular Formula | C18H18N2OS2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | azepan-1-yl-[5-(1,3-benzothiazol-2-yl)thiophen-2-yl]methanone |
| SMILES | O=C(c1ccc(-c2nc3ccccc3s2)s1)N1CCCCCC1 |
| InChI | InChI=1S/C18H18N2OS2/c21-18(20-11-5-1-2-6-12-20)16-10-9-15(22-16)17-19-13-7-3-4-8-14(13)23-17/h3-4,7-10H,1-2,5-6,11-12H2 |
| InChIKey | CJFJSMHZJGRNSQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |