C7H9N5O2S — CID 80615710
4-(5-amino-1,3,4-thiadiazole-2-carbonyl)piperazin-2-one (PubChem CID 80615710) has the molecular formula C7H9N5O2S and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-(5-amino-1,3,4-thiadiazole-2-carbonyl)piperazin-2-one.
| Compound Name | 4-(5-amino-1,3,4-thiadiazole-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 80615710 |
| Molecular Formula | C7H9N5O2S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 4-(5-amino-1,3,4-thiadiazole-2-carbonyl)piperazin-2-one |
| SMILES | Nc1nnc(C(=O)N2CCNC(=O)C2)s1 |
| InChI | InChI=1S/C7H9N5O2S/c8-7-11-10-5(15-7)6(14)12-2-1-9-4(13)3-12/h1-3H2,(H2,8,11)(H,9,13) |
| InChIKey | PYNKAIMIZOCPNR-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |