C31H48F2N2O6 — CID 58075989
N-[(2S,11S,12R)-1-(2,5-difluorophenyl)-12-(2,2-dimethylpropanoylamino)-11,13-dihydroxy-7,7-dimethyl-4,10-dioxotridecan-2-yl]-2,2-dimethylpropanamide (PubChem CID 58075989) has the molecular formula C31H48F2N2O6 and a molecular weight of 582.73 g/mol. Its IUPAC name is N-[(2S,11S,12R)-1-(2,5-difluorophenyl)-12-(2,2-dimethylpropanoylamino)-11,13-dihydroxy-7,7-dimethyl-4,10-dioxotridecan-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2S,11S,12R)-1-(2,5-difluorophenyl)-12-(2,2-dimethylpropanoylamino)-11,13-dihydroxy-7,7-dimethyl-4,10-dioxotridecan-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 58075989 |
| Molecular Formula | C31H48F2N2O6 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.35 |
| IUPAC Name | N-[(2S,11S,12R)-1-(2,5-difluorophenyl)-12-(2,2-dimethylpropanoylamino)-11,13-dihydroxy-7,7-dimethyl-4,10-dioxotridecan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCC(=O)C[C@H](Cc1cc(F)ccc1F)NC(=O)C(C)(C)C)CCC(=O)[C@@H](O)[C@@H](CO)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H48F2N2O6/c1-29(2,3)27(40)34-21(16-19-15-20(32)9-10-23(19)33)17-22(37)11-13-31(7,8)14-12-25(38)26(39)24(18-36)35-28(41)30(4,5)6/h9-10,15,21,24,26,36,39H,11-14,16-18H2,1-8H3,(H,34,40)(H,35,41)/t21-,24+,26-/m0/s1 |
| InChIKey | VCCYYTQCDSCKMD-NZJKTDFXSA-N |
| XLogP | 4.04 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |