C21H32F2N2O4 — CID 58075995
2,12-diamino-13-(2,5-difluorophenyl)-1,3-dihydroxy-7,7-dimethyltridecane-4,10-dione (PubChem CID 58075995) has the molecular formula C21H32F2N2O4 and a molecular weight of 414.49 g/mol. Its IUPAC name is 2,12-diamino-13-(2,5-difluorophenyl)-1,3-dihydroxy-7,7-dimethyltridecane-4,10-dione.
| Compound Name | 2,12-diamino-13-(2,5-difluorophenyl)-1,3-dihydroxy-7,7-dimethyltridecane-4,10-dione |
|---|---|
| PubChem CID | 58075995 |
| Molecular Formula | C21H32F2N2O4 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2,12-diamino-13-(2,5-difluorophenyl)-1,3-dihydroxy-7,7-dimethyltridecane-4,10-dione |
| SMILES | CC(C)(CCC(=O)CC(N)Cc1cc(F)ccc1F)CCC(=O)C(O)C(N)CO |
| InChI | InChI=1S/C21H32F2N2O4/c1-21(2,8-6-19(28)20(29)18(25)12-26)7-5-16(27)11-15(24)10-13-9-14(22)3-4-17(13)23/h3-4,9,15,18,20,26,29H,5-8,10-12,24-25H2,1-2H3 |
| InChIKey | MCOCRHLUJXXBDZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |