C33H46F2N2O4 — CID 158270679
[2,12-diamino-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenyltridecan-3-yl] hexanoate (PubChem CID 158270679) has the molecular formula C33H46F2N2O4 and a molecular weight of 572.74 g/mol. Its IUPAC name is [2,12-diamino-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenyltridecan-3-yl] hexanoate.
| Compound Name | [2,12-diamino-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenyltridecan-3-yl] hexanoate |
|---|---|
| PubChem CID | 158270679 |
| Molecular Formula | C33H46F2N2O4 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | [2,12-diamino-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenyltridecan-3-yl] hexanoate |
| SMILES | CCCCCC(=O)OC(C(=O)CCC(C)(C)CCC(=O)CC(N)Cc1cc(F)ccc1F)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C33H46F2N2O4/c1-4-5-7-12-31(40)41-32(29(37)19-23-10-8-6-9-11-23)30(39)16-18-33(2,3)17-15-27(38)22-26(36)21-24-20-25(34)13-14-28(24)35/h6,8-11,13-14,20,26,29,32H,4-5,7,12,15-19,21-22,36-37H2,1-3H3 |
| InChIKey | GIZJGIYDYIDPDB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|