C43H62F2N2O9 — CID 58075870
[13-(2,5-difluorophenyl)-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] 2,2-dimethylpropanoate (PubChem CID 58075870) has the molecular formula C43H62F2N2O9 and a molecular weight of 788.97 g/mol. Its IUPAC name is [13-(2,5-difluorophenyl)-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [13-(2,5-difluorophenyl)-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58075870 |
| Molecular Formula | C43H62F2N2O9 |
| Molecular Weight | 788.97 g/mol |
| Exact Mass | 788.44 |
| IUPAC Name | [13-(2,5-difluorophenyl)-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(CCC(=O)CC(Cc1cc(F)ccc1F)NC(=O)OC(C)(C)C)CCC(=O)C(OC(=O)C(C)(C)C)C(COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C43H62F2N2O9/c1-40(2,3)37(50)54-36(34(47-39(52)56-42(7,8)9)27-53-26-28-15-13-12-14-16-28)35(49)20-22-43(10,11)21-19-32(48)25-31(46-38(51)55-41(4,5)6)24-29-23-30(44)17-18-33(29)45/h12-18,23,31,34,36H,19-22,24-27H2,1-11H3,(H,46,51)(H,47,52) |
| InChIKey | FDTABSRNFSRVFH-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.97 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|