C43H54F2N2O9 — CID 58076046
[(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxy-12-(phenylmethoxycarbonylamino)tridecan-3-yl] acetate (PubChem CID 58076046) has the molecular formula C43H54F2N2O9 and a molecular weight of 780.91 g/mol. Its IUPAC name is [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxy-12-(phenylmethoxycarbonylamino)tridecan-3-yl] acetate.
| Compound Name | [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxy-12-(phenylmethoxycarbonylamino)tridecan-3-yl] acetate |
|---|---|
| PubChem CID | 58076046 |
| Molecular Formula | C43H54F2N2O9 |
| Molecular Weight | 780.91 g/mol |
| Exact Mass | 780.38 |
| IUPAC Name | [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxy-12-(phenylmethoxycarbonylamino)tridecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)CCC(C)(C)CCC(=O)CC(Cc1cc(F)ccc1F)NC(=O)OCc1ccccc1)[C@@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C43H54F2N2O9/c1-29(48)55-39(37(47-41(52)56-42(2,3)4)28-53-26-30-13-9-7-10-14-30)38(50)20-22-43(5,6)21-19-35(49)25-34(24-32-23-33(44)17-18-36(32)45)46-40(51)54-27-31-15-11-8-12-16-31/h7-18,23,34,37,39H,19-22,24-28H2,1-6H3,(H,46,51)(H,47,52)/t34?,37-,39+/m1/s1 |
| InChIKey | MMTODMRZSKDNTB-IBERSWSOSA-N |
| XLogP | 7.96 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.91 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|