C19H21F2NO2 — CID 59009732
ethyl 3-(benzylamino)-4-(2,5-difluorophenyl)butanoate (PubChem CID 59009732) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is ethyl 3-(benzylamino)-4-(2,5-difluorophenyl)butanoate.
| Compound Name | ethyl 3-(benzylamino)-4-(2,5-difluorophenyl)butanoate |
|---|---|
| PubChem CID | 59009732 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | ethyl 3-(benzylamino)-4-(2,5-difluorophenyl)butanoate |
| SMILES | CCOC(=O)CC(Cc1cc(F)ccc1F)NCc1ccccc1 |
| InChI | InChI=1S/C19H21F2NO2/c1-2-24-19(23)12-17(22-13-14-6-4-3-5-7-14)11-15-10-16(20)8-9-18(15)21/h3-10,17,22H,2,11-13H2,1H3 |
| InChIKey | GMZUNLDSNLVOEF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |