C23H36O7 — CID 58077727
[(2R)-2-acetyloxy-2-[(4S,6S,7S,7aS)-7-methyl-6-[(E)-pent-2-enyl]spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]ethyl] acetate (PubChem CID 58077727) has the molecular formula C23H36O7 and a molecular weight of 424.53 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(4S,6S,7S,7aS)-7-methyl-6-[(E)-pent-2-enyl]spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-2-[(4S,6S,7S,7aS)-7-methyl-6-[(E)-pent-2-enyl]spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]ethyl] acetate |
|---|---|
| PubChem CID | 58077727 |
| Molecular Formula | C23H36O7 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(4S,6S,7S,7aS)-7-methyl-6-[(E)-pent-2-enyl]spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]ethyl] acetate |
| SMILES | CC/C=C/C[C@@H]1O[C@@H]([C@@H](COC(C)=O)OC(C)=O)C2OC3(CCCCC3)O[C@H]2[C@H]1C |
| InChI | InChI=1S/C23H36O7/c1-5-6-8-11-18-15(2)20-22(30-23(29-20)12-9-7-10-13-23)21(28-18)19(27-17(4)25)14-26-16(3)24/h6,8,15,18-22H,5,7,9-14H2,1-4H3/b8-6+/t15-,18-,19+,20-,21-,22?/m0/s1 |
| InChIKey | FRXCEGPRFHMBCZ-SAKDWTRJSA-N |
| XLogP | 3.69 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|