C26H23F3N4O — CID 58079421
1-(3-methyl-3,5,12-triazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-6-yl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-one (PubChem CID 58079421) has the molecular formula C26H23F3N4O and a molecular weight of 464.49 g/mol. Its IUPAC name is 1-(3-methyl-3,5,12-triazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-6-yl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-one.
| Compound Name | 1-(3-methyl-3,5,12-triazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-6-yl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 58079421 |
| Molecular Formula | C26H23F3N4O |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-(3-methyl-3,5,12-triazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-6-yl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(-c5ccc(C(F)(F)F)cc5)cc4=O)nc31)CN1CCC2CC1 |
| InChI | InChI=1S/C26H23F3N4O/c1-31-24-17-8-11-32(12-9-17)15-21(24)20-6-7-22(30-25(20)31)33-13-10-18(14-23(33)34)16-2-4-19(5-3-16)26(27,28)29/h2-7,10,13-14,17H,8-9,11-12,15H2,1H3 |
| InChIKey | NBDPMAUQGFUHFV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |