C21H26N6O2 — CID 58082427
2-[(4-hydroxycyclohexyl)amino]-N-(3-pyrazol-1-ylpropyl)quinazoline-7-carboxamide (PubChem CID 58082427) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[(4-hydroxycyclohexyl)amino]-N-(3-pyrazol-1-ylpropyl)quinazoline-7-carboxamide.
| Compound Name | 2-[(4-hydroxycyclohexyl)amino]-N-(3-pyrazol-1-ylpropyl)quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 58082427 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-[(4-hydroxycyclohexyl)amino]-N-(3-pyrazol-1-ylpropyl)quinazoline-7-carboxamide |
| SMILES | O=C(NCCCn1cccn1)c1ccc2cnc(NC3CCC(O)CC3)nc2c1 |
| InChI | InChI=1S/C21H26N6O2/c28-18-7-5-17(6-8-18)25-21-23-14-16-4-3-15(13-19(16)26-21)20(29)22-9-1-11-27-12-2-10-24-27/h2-4,10,12-14,17-18,28H,1,5-9,11H2,(H,22,29)(H,23,25,26) |
| InChIKey | UCYXNPGZGZXRNW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|