C23H26N4O3 — CID 58082242
2-[(4-hydroxycyclohexyl)amino]-N-[(1R)-2-hydroxy-1-phenylethyl]quinazoline-7-carboxamide (PubChem CID 58082242) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[(4-hydroxycyclohexyl)amino]-N-[(1R)-2-hydroxy-1-phenylethyl]quinazoline-7-carboxamide.
| Compound Name | 2-[(4-hydroxycyclohexyl)amino]-N-[(1R)-2-hydroxy-1-phenylethyl]quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 58082242 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-[(4-hydroxycyclohexyl)amino]-N-[(1R)-2-hydroxy-1-phenylethyl]quinazoline-7-carboxamide |
| SMILES | O=C(N[C@@H](CO)c1ccccc1)c1ccc2cnc(NC3CCC(O)CC3)nc2c1 |
| InChI | InChI=1S/C23H26N4O3/c28-14-21(15-4-2-1-3-5-15)26-22(30)16-6-7-17-13-24-23(27-20(17)12-16)25-18-8-10-19(29)11-9-18/h1-7,12-13,18-19,21,28-29H,8-11,14H2,(H,26,30)(H,24,25,27)/t18?,19?,21-/m0/s1 |
| InChIKey | JMGOMFPFAFIMKH-GRERDSQWSA-N |
| XLogP | 2.81 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |