C27H33N3O2 — CID 143569953
2-[3-(4-hydroxycyclohexyl)propyl]-N-[(1R)-1-phenylpropyl]quinazoline-7-carboxamide (PubChem CID 143569953) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-[3-(4-hydroxycyclohexyl)propyl]-N-[(1R)-1-phenylpropyl]quinazoline-7-carboxamide.
| Compound Name | 2-[3-(4-hydroxycyclohexyl)propyl]-N-[(1R)-1-phenylpropyl]quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 143569953 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2-[3-(4-hydroxycyclohexyl)propyl]-N-[(1R)-1-phenylpropyl]quinazoline-7-carboxamide |
| SMILES | CC[C@@H](NC(=O)c1ccc2cnc(CCCC3CCC(O)CC3)nc2c1)c1ccccc1 |
| InChI | InChI=1S/C27H33N3O2/c1-2-24(20-8-4-3-5-9-20)30-27(32)21-13-14-22-18-28-26(29-25(22)17-21)10-6-7-19-11-15-23(31)16-12-19/h3-5,8-9,13-14,17-19,23-24,31H,2,6-7,10-12,15-16H2,1H3,(H,30,32)/t19?,23?,24-/m1/s1 |
| InChIKey | VXMSXZFNSBDFKU-PBSMCPNCSA-N |
| XLogP | 5.38 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |