C23H25N5O2 — CID 58082700
2-[(4-hydroxycyclohexyl)amino]-N-(1-pyridin-4-ylcyclopropyl)quinazoline-8-carboxamide (PubChem CID 58082700) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-[(4-hydroxycyclohexyl)amino]-N-(1-pyridin-4-ylcyclopropyl)quinazoline-8-carboxamide.
| Compound Name | 2-[(4-hydroxycyclohexyl)amino]-N-(1-pyridin-4-ylcyclopropyl)quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 58082700 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[(4-hydroxycyclohexyl)amino]-N-(1-pyridin-4-ylcyclopropyl)quinazoline-8-carboxamide |
| SMILES | O=C(NC1(c2ccncc2)CC1)c1cccc2cnc(NC3CCC(O)CC3)nc12 |
| InChI | InChI=1S/C23H25N5O2/c29-18-6-4-17(5-7-18)26-22-25-14-15-2-1-3-19(20(15)27-22)21(30)28-23(10-11-23)16-8-12-24-13-9-16/h1-3,8-9,12-14,17-18,29H,4-7,10-11H2,(H,28,30)(H,25,26,27) |
| InChIKey | JPDZFOAOGFXODT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |