C22H29N5O3 — CID 58082546
N-(1-acetylpiperidin-4-yl)-2-[(4-hydroxycyclohexyl)amino]quinazoline-8-carboxamide (PubChem CID 58082546) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-2-[(4-hydroxycyclohexyl)amino]quinazoline-8-carboxamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-2-[(4-hydroxycyclohexyl)amino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 58082546 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-2-[(4-hydroxycyclohexyl)amino]quinazoline-8-carboxamide |
| SMILES | CC(=O)N1CCC(NC(=O)c2cccc3cnc(NC4CCC(O)CC4)nc23)CC1 |
| InChI | InChI=1S/C22H29N5O3/c1-14(28)27-11-9-17(10-12-27)24-21(30)19-4-2-3-15-13-23-22(26-20(15)19)25-16-5-7-18(29)8-6-16/h2-4,13,16-18,29H,5-12H2,1H3,(H,24,30)(H,23,25,26) |
| InChIKey | ZCDPEIOVWDNLJT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |