C21H27FN4O — CID 58082819
(6S)-2-amino-6-[2-fluoro-5-[(2-isocyanocyclopentyl)methyl]phenyl]-3,5,5,6-tetramethylpyrimidin-4-one (PubChem CID 58082819) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is (6S)-2-amino-6-[2-fluoro-5-[(2-isocyanocyclopentyl)methyl]phenyl]-3,5,5,6-tetramethylpyrimidin-4-one.
| Compound Name | (6S)-2-amino-6-[2-fluoro-5-[(2-isocyanocyclopentyl)methyl]phenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 58082819 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (6S)-2-amino-6-[2-fluoro-5-[(2-isocyanocyclopentyl)methyl]phenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
| SMILES | [C-]#[N+]C1CCCC1Cc1ccc(F)c([C@@]2(C)N=C(N)N(C)C(=O)C2(C)C)c1 |
| InChI | InChI=1S/C21H27FN4O/c1-20(2)18(27)26(5)19(23)25-21(20,3)15-12-13(9-10-16(15)22)11-14-7-6-8-17(14)24-4/h9-10,12,14,17H,6-8,11H2,1-3,5H3,(H2,23,25)/t14?,17?,21-/m1/s1 |
| InChIKey | DZLFSAXKOPPSOE-KDDGLUCOSA-N |
| XLogP | 3.48 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|