C16H11ClF2N4O2 — CID 58083506
2-[(5-chloro-2-hydroxyphenyl)methyl]-N-(2,6-difluorophenyl)triazole-4-carboxamide (PubChem CID 58083506) has the molecular formula C16H11ClF2N4O2 and a molecular weight of 364.74 g/mol. Its IUPAC name is 2-[(5-chloro-2-hydroxyphenyl)methyl]-N-(2,6-difluorophenyl)triazole-4-carboxamide.
| Compound Name | 2-[(5-chloro-2-hydroxyphenyl)methyl]-N-(2,6-difluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 58083506 |
| Molecular Formula | C16H11ClF2N4O2 |
| Molecular Weight | 364.74 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-[(5-chloro-2-hydroxyphenyl)methyl]-N-(2,6-difluorophenyl)triazole-4-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cnn(Cc2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C16H11ClF2N4O2/c17-10-4-5-14(24)9(6-10)8-23-20-7-13(22-23)16(25)21-15-11(18)2-1-3-12(15)19/h1-7,24H,8H2,(H,21,25) |
| InChIKey | PUROAONJDHLZGS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|