C19H15N6O — CID 58084336
CID 58084336 (PubChem CID 58084336) has the molecular formula C19H15N6O and a molecular weight of 343.37 g/mol.
| Compound Name | CID 58084336 |
|---|---|
| PubChem CID | 58084336 |
| Molecular Formula | C19H15N6O |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc2nc(-c3nc(C(=O)Nc4ccccc4)cnc3[NH])[nH]c2c1 |
| InChI | InChI=1S/C19H15N6O/c1-11-7-8-13-14(9-11)25-18(24-13)16-17(20)21-10-15(23-16)19(26)22-12-5-3-2-4-6-12/h2-10,20H,1H3,(H,22,26)(H,24,25) |
| InChIKey | CDIMCTZNVURGGB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |