C18H19FN2 — CID 58088567
3-(4-fluorophenyl)-3-indol-1-yl-N-methylpropan-1-amine (PubChem CID 58088567) has the molecular formula C18H19FN2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-indol-1-yl-N-methylpropan-1-amine.
| Compound Name | 3-(4-fluorophenyl)-3-indol-1-yl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 58088567 |
| Molecular Formula | C18H19FN2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-(4-fluorophenyl)-3-indol-1-yl-N-methylpropan-1-amine |
| SMILES | CNCCC(c1ccc(F)cc1)n1ccc2ccccc21 |
| InChI | InChI=1S/C18H19FN2/c1-20-12-10-18(15-6-8-16(19)9-7-15)21-13-11-14-4-2-3-5-17(14)21/h2-9,11,13,18,20H,10,12H2,1H3 |
| InChIKey | HRLJDOKNAQMBOA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |