C16H19N5O4S — CID 58088979
5-amino-1-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-3-methylperoxysulfanylpyrazole-4-carboxamide (PubChem CID 58088979) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is 5-amino-1-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-3-methylperoxysulfanylpyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-3-methylperoxysulfanylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 58088979 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 5-amino-1-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-3-methylperoxysulfanylpyrazole-4-carboxamide |
| SMILES | COOSc1nn(-c2cc(C(=O)NC3CC3)ccc2C)c(N)c1C(N)=O |
| InChI | InChI=1S/C16H19N5O4S/c1-8-3-4-9(15(23)19-10-5-6-10)7-11(8)21-13(17)12(14(18)22)16(20-21)26-25-24-2/h3-4,7,10H,5-6,17H2,1-2H3,(H2,18,22)(H,19,23) |
| InChIKey | UYYYIYIKEYMHOZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|