C25H38O4 — CID 58090272
[4-[4-(2-methoxyethyl)cyclohexyl]cyclohexyl] 4-(2-methoxyethyl)benzoate (PubChem CID 58090272) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is [4-[4-(2-methoxyethyl)cyclohexyl]cyclohexyl] 4-(2-methoxyethyl)benzoate.
| Compound Name | [4-[4-(2-methoxyethyl)cyclohexyl]cyclohexyl] 4-(2-methoxyethyl)benzoate |
|---|---|
| PubChem CID | 58090272 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [4-[4-(2-methoxyethyl)cyclohexyl]cyclohexyl] 4-(2-methoxyethyl)benzoate |
| SMILES | COCCc1ccc(C(=O)OC2CCC(C3CCC(CCOC)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H38O4/c1-27-17-15-19-3-7-21(8-4-19)22-11-13-24(14-12-22)29-25(26)23-9-5-20(6-10-23)16-18-28-2/h5-6,9-10,19,21-22,24H,3-4,7-8,11-18H2,1-2H3 |
| InChIKey | AQPOIFBNJHCJOT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |