C22H29N5O2 — CID 58090810
1-(4-cyclobutylpiperazin-1-yl)-2-(5-cyclopropyl-8-oxa-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone (PubChem CID 58090810) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-(5-cyclopropyl-8-oxa-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-(5-cyclopropyl-8-oxa-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone |
|---|---|
| PubChem CID | 58090810 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-(5-cyclopropyl-8-oxa-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone |
| SMILES | O=C(CN1CCc2c(oc3nc(C4CC4)ncc23)C1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C22H29N5O2/c28-20(27-10-8-26(9-11-27)16-2-1-3-16)14-25-7-6-17-18-12-23-21(15-4-5-15)24-22(18)29-19(17)13-25/h12,15-16H,1-11,13-14H2 |
| InChIKey | VUWAECAOTVRAPQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |