C25H29N5OS — CID 58090861
1-(4-cyclobutylpiperazin-1-yl)-2-(5-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone (PubChem CID 58090861) has the molecular formula C25H29N5OS and a molecular weight of 447.61 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-(5-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-(5-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone |
|---|---|
| PubChem CID | 58090861 |
| Molecular Formula | C25H29N5OS |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-(5-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)ethanone |
| SMILES | O=C(CN1CCc2c(sc3nc(-c4ccccc4)ncc23)C1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C25H29N5OS/c31-23(30-13-11-29(12-14-30)19-7-4-8-19)17-28-10-9-20-21-15-26-24(18-5-2-1-3-6-18)27-25(21)32-22(20)16-28/h1-3,5-6,15,19H,4,7-14,16-17H2 |
| InChIKey | JKTMTVBGXMDAPL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |