C27H42O6 — CID 58090971
(2R,3R,4S)-4-hydroxy-3-[10-hydroxy-9-(hydroxymethyl)-7-oxodecyl]-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentan-1-one (PubChem CID 58090971) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is (2R,3R,4S)-4-hydroxy-3-[10-hydroxy-9-(hydroxymethyl)-7-oxodecyl]-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4S)-4-hydroxy-3-[10-hydroxy-9-(hydroxymethyl)-7-oxodecyl]-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 58090971 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (2R,3R,4S)-4-hydroxy-3-[10-hydroxy-9-(hydroxymethyl)-7-oxodecyl]-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentan-1-one |
| SMILES | O=C(CCCCCC[C@H]1[C@@H](O)CC(=O)[C@@H]1CC[C@@H](O)CCc1ccccc1)CC(CO)CO |
| InChI | InChI=1S/C27H42O6/c28-18-21(19-29)16-23(31)10-6-1-2-7-11-24-25(27(33)17-26(24)32)15-14-22(30)13-12-20-8-4-3-5-9-20/h3-5,8-9,21-22,24-26,28-30,32H,1-2,6-7,10-19H2/t22-,24+,25+,26-/m0/s1 |
| InChIKey | VUTJIPFZGQBBIE-CDCCBSOTSA-N |
| XLogP | 3.23 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|