C32H52O3Y — CID 58091728
(4aS,6aS,6bR,9S,10S,12aS)-9-ethyl-10-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid;yttrium (PubChem CID 58091728) has the molecular formula C32H52O3Y and a molecular weight of 573.67 g/mol. Its IUPAC name is (4aS,6aS,6bR,9S,10S,12aS)-9-ethyl-10-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid;yttrium.
| Compound Name | (4aS,6aS,6bR,9S,10S,12aS)-9-ethyl-10-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 58091728 |
| Molecular Formula | C32H52O3Y |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | (4aS,6aS,6bR,9S,10S,12aS)-9-ethyl-10-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid;yttrium |
| SMILES | CC[C@@]1(C)C2CC[C@]3(C)C(CC=C4C5CC(C)(C)CC[C@]5(C(=O)O)CC[C@]43C)[C@@]2(C)CC[C@@H]1CO.[Y] |
| InChI | InChI=1S/C32H52O3.Y/c1-8-28(4)21(20-33)11-13-29(5)24(28)12-14-31(7)25(29)10-9-22-23-19-27(2,3)15-17-32(23,26(34)35)18-16-30(22,31)6;/h9,21,23-25,33H,8,10-20H2,1-7H3,(H,34,35);/t21-,23?,24?,25?,28-,29+,30-,31-,32+;/m1./s1 |
| InChIKey | VQFBKVFMTBXPDK-HCBUGPGFSA-N |
| XLogP | 7.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|