C16H20N2O2 — CID 58092178
2,6-diethyl-5-methoxy-4-(2-methylphenyl)pyridazin-3-one (PubChem CID 58092178) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2,6-diethyl-5-methoxy-4-(2-methylphenyl)pyridazin-3-one.
| Compound Name | 2,6-diethyl-5-methoxy-4-(2-methylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 58092178 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2,6-diethyl-5-methoxy-4-(2-methylphenyl)pyridazin-3-one |
| SMILES | CCc1nn(CC)c(=O)c(-c2ccccc2C)c1OC |
| InChI | InChI=1S/C16H20N2O2/c1-5-13-15(20-4)14(16(19)18(6-2)17-13)12-10-8-7-9-11(12)3/h7-10H,5-6H2,1-4H3 |
| InChIKey | VAROXYMKSGPRLF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |