C21H21ClN2O2 — CID 59400732
6-[2-(4-chlorophenyl)ethyl]-2-ethyl-5-hydroxy-4-(2-methylphenyl)pyridazin-3-one (PubChem CID 59400732) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 6-[2-(4-chlorophenyl)ethyl]-2-ethyl-5-hydroxy-4-(2-methylphenyl)pyridazin-3-one.
| Compound Name | 6-[2-(4-chlorophenyl)ethyl]-2-ethyl-5-hydroxy-4-(2-methylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 59400732 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6-[2-(4-chlorophenyl)ethyl]-2-ethyl-5-hydroxy-4-(2-methylphenyl)pyridazin-3-one |
| SMILES | CCn1nc(CCc2ccc(Cl)cc2)c(O)c(-c2ccccc2C)c1=O |
| InChI | InChI=1S/C21H21ClN2O2/c1-3-24-21(26)19(17-7-5-4-6-14(17)2)20(25)18(23-24)13-10-15-8-11-16(22)12-9-15/h4-9,11-12,25H,3,10,13H2,1-2H3 |
| InChIKey | NOXIQNQEGJANEO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |