C11H20FN3O2 — CID 58093314
5-(2-amino-3-fluoropropyl)-1-tert-butylpiperazine-2,3-dione (PubChem CID 58093314) has the molecular formula C11H20FN3O2 and a molecular weight of 245.30 g/mol. Its IUPAC name is 5-(2-amino-3-fluoropropyl)-1-tert-butylpiperazine-2,3-dione.
| Compound Name | 5-(2-amino-3-fluoropropyl)-1-tert-butylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 58093314 |
| Molecular Formula | C11H20FN3O2 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-(2-amino-3-fluoropropyl)-1-tert-butylpiperazine-2,3-dione |
| SMILES | CC(C)(C)N1CC(CC(N)CF)NC(=O)C1=O |
| InChI | InChI=1S/C11H20FN3O2/c1-11(2,3)15-6-8(4-7(13)5-12)14-9(16)10(15)17/h7-8H,4-6,13H2,1-3H3,(H,14,16) |
| InChIKey | YPWKGYSAHSAHGN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|