C18H8Cl2FN5S — CID 58094922
4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophene-3-carbonitrile (PubChem CID 58094922) has the molecular formula C18H8Cl2FN5S and a molecular weight of 416.27 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophene-3-carbonitrile.
| Compound Name | 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 58094922 |
| Molecular Formula | C18H8Cl2FN5S |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophene-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccnc(F)c2)sc(-c2cn[nH]n2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H8Cl2FN5S/c19-10-1-2-11(13(20)6-10)16-12(7-22)17(9-3-4-23-15(21)5-9)27-18(16)14-8-24-26-25-14/h1-6,8H,(H,24,25,26) |
| InChIKey | QVYJYTIXSJVMML-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|