C21H37NO — CID 58098931
(NE)-N-[(6S,11S)-2,6,11,15-tetramethyl-9-methylidenehexadeca-2,14-dien-8-ylidene]hydroxylamine (PubChem CID 58098931) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is (NE)-N-[(6S,11S)-2,6,11,15-tetramethyl-9-methylidenehexadeca-2,14-dien-8-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(6S,11S)-2,6,11,15-tetramethyl-9-methylidenehexadeca-2,14-dien-8-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 58098931 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | (NE)-N-[(6S,11S)-2,6,11,15-tetramethyl-9-methylidenehexadeca-2,14-dien-8-ylidene]hydroxylamine |
| SMILES | C=C(C[C@@H](C)CCC=C(C)C)/C(C[C@@H](C)CCC=C(C)C)=N/O |
| InChI | InChI=1S/C21H37NO/c1-16(2)10-8-12-18(5)14-20(7)21(22-23)15-19(6)13-9-11-17(3)4/h10-11,18-19,23H,7-9,12-15H2,1-6H3/b22-21+/t18-,19-/m0/s1 |
| InChIKey | ALBPXFJTSWJMAS-YTCPRFGJSA-N |
| XLogP | 6.92 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|