C12H21N — CID 58099971
3,4-ditert-butyl-2H-pyrrole (PubChem CID 58099971) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 3,4-ditert-butyl-2H-pyrrole.
| Compound Name | 3,4-ditert-butyl-2H-pyrrole |
|---|---|
| PubChem CID | 58099971 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3,4-ditert-butyl-2H-pyrrole |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)CN=C1 |
| InChI | InChI=1S/C12H21N/c1-11(2,3)9-7-13-8-10(9)12(4,5)6/h7H,8H2,1-6H3 |
| InChIKey | MDLILOQTVXEFNR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |