About 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten
4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten (PubChem CID 59058980) has the molecular formula C8H12NW-
and a molecular weight of 306.03 g/mol. Its IUPAC name is 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten.
Molecular Properties
| Compound Name | 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten |
| PubChem CID | 59058980 |
| Molecular Formula | C8H12NW- |
| Molecular Weight | 306.03 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten |
| SMILES | CC(C)(C)C1=[C-]CN=C1.[W] |
| InChI | InChI=1S/C8H12N.W/c1-8(2,3)7-4-5-9-6-7;/h6H,5H2,1-3H3;/q-1; |
| InChIKey | BGSRXFUKWYMAOG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.03 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten?
The IUPAC name of 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten (CID 59058980) is 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten.
What is the SMILES notation for 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten?
The canonical SMILES for 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten is CC(C)(C)C1=[C-]CN=C1.[W].
What is the InChIKey of 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten?
The InChIKey is BGSRXFUKWYMAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N.W/c1-8(2,3)7-4-5-9-6-7;/h6H,5H2,1-3H3;/q-1;.
What are the key properties of 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten?
4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten has a molecular weight of 306.03 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,3-dihydropyrrol-3-ide;tungsten is sourced from PubChem (CID 59058980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).